C17H32O3Si2 — CID 152723809
tert-butyl-dimethyl-[4-(2-trimethoxysilylethyl)phenyl]silane (PubChem CID 152723809) has the molecular formula C17H32O3Si2 and a molecular weight of 340.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-(2-trimethoxysilylethyl)phenyl]silane.
| Compound Name | tert-butyl-dimethyl-[4-(2-trimethoxysilylethyl)phenyl]silane |
|---|---|
| PubChem CID | 152723809 |
| Molecular Formula | C17H32O3Si2 |
| Molecular Weight | 340.61 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | tert-butyl-dimethyl-[4-(2-trimethoxysilylethyl)phenyl]silane |
| SMILES | CO[Si](CCc1ccc([Si](C)(C)C(C)(C)C)cc1)(OC)OC |
| InChI | InChI=1S/C17H32O3Si2/c1-17(2,3)21(7,8)16-11-9-15(10-12-16)13-14-22(18-4,19-5)20-6/h9-12H,13-14H2,1-8H3 |
| InChIKey | ZWEHUJQYDLOTIP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|