C24H34O6Si2 — CID 123741554
8-hydroxyocta-3,5,7-triyn-2-one;trimethoxy-[2-[4-[2-[methoxy(dimethyl)silyl]ethyl]phenyl]ethyl]silane (PubChem CID 123741554) has the molecular formula C24H34O6Si2 and a molecular weight of 474.70 g/mol. Its IUPAC name is 8-hydroxyocta-3,5,7-triyn-2-one;trimethoxy-[2-[4-[2-[methoxy(dimethyl)silyl]ethyl]phenyl]ethyl]silane.
| Compound Name | 8-hydroxyocta-3,5,7-triyn-2-one;trimethoxy-[2-[4-[2-[methoxy(dimethyl)silyl]ethyl]phenyl]ethyl]silane |
|---|---|
| PubChem CID | 123741554 |
| Molecular Formula | C24H34O6Si2 |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 8-hydroxyocta-3,5,7-triyn-2-one;trimethoxy-[2-[4-[2-[methoxy(dimethyl)silyl]ethyl]phenyl]ethyl]silane |
| SMILES | CC(=O)C#CC#CC#CO.CO[Si](C)(C)CCc1ccc(CC[Si](OC)(OC)OC)cc1 |
| InChI | InChI=1S/C16H30O4Si2.C8H4O2/c1-17-21(5,6)13-11-15-7-9-16(10-8-15)12-14-22(18-2,19-3)20-4;1-8(10)6-4-2-3-5-7-9/h7-10H,11-14H2,1-6H3;9H,1H3 |
| InChIKey | VIAGIFOUUGBTHI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.70 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|