C18H19F5O5SSi — CID 90226967
trimethoxy-[2-[4-[(2,3,4,5,6-pentafluorophenyl)sulfonylmethyl]phenyl]ethyl]silane (PubChem CID 90226967) has the molecular formula C18H19F5O5SSi and a molecular weight of 470.49 g/mol. Its IUPAC name is trimethoxy-[2-[4-[(2,3,4,5,6-pentafluorophenyl)sulfonylmethyl]phenyl]ethyl]silane.
| Compound Name | trimethoxy-[2-[4-[(2,3,4,5,6-pentafluorophenyl)sulfonylmethyl]phenyl]ethyl]silane |
|---|---|
| PubChem CID | 90226967 |
| Molecular Formula | C18H19F5O5SSi |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | trimethoxy-[2-[4-[(2,3,4,5,6-pentafluorophenyl)sulfonylmethyl]phenyl]ethyl]silane |
| SMILES | CO[Si](CCc1ccc(CS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1)(OC)OC |
| InChI | InChI=1S/C18H19F5O5SSi/c1-26-30(27-2,28-3)9-8-11-4-6-12(7-5-11)10-29(24,25)18-16(22)14(20)13(19)15(21)17(18)23/h4-7H,8-10H2,1-3H3 |
| InChIKey | KQIQXVRLQWWDOR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|