C11H17BrO4SSi — CID 139944643
4-[2-[dimethoxy(methyl)silyl]ethyl]benzenesulfonyl bromide (PubChem CID 139944643) has the molecular formula C11H17BrO4SSi and a molecular weight of 353.31 g/mol. Its IUPAC name is 4-[2-[dimethoxy(methyl)silyl]ethyl]benzenesulfonyl bromide.
| Compound Name | 4-[2-[dimethoxy(methyl)silyl]ethyl]benzenesulfonyl bromide |
|---|---|
| PubChem CID | 139944643 |
| Molecular Formula | C11H17BrO4SSi |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 4-[2-[dimethoxy(methyl)silyl]ethyl]benzenesulfonyl bromide |
| SMILES | CO[Si](C)(CCc1ccc(S(=O)(=O)Br)cc1)OC |
| InChI | InChI=1S/C11H17BrO4SSi/c1-15-18(3,16-2)9-8-10-4-6-11(7-5-10)17(12,13)14/h4-7H,8-9H2,1-3H3 |
| InChIKey | CWTAGQOXKMMCAB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|