C15H30O6SSi2 — CID 157471412
4-[2-[dimethoxy(methyl)silyl]ethyl]benzenesulfonic acid;methoxy(trimethyl)silane (PubChem CID 157471412) has the molecular formula C15H30O6SSi2 and a molecular weight of 394.64 g/mol. Its IUPAC name is 4-[2-[dimethoxy(methyl)silyl]ethyl]benzenesulfonic acid;methoxy(trimethyl)silane.
| Compound Name | 4-[2-[dimethoxy(methyl)silyl]ethyl]benzenesulfonic acid;methoxy(trimethyl)silane |
|---|---|
| PubChem CID | 157471412 |
| Molecular Formula | C15H30O6SSi2 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 4-[2-[dimethoxy(methyl)silyl]ethyl]benzenesulfonic acid;methoxy(trimethyl)silane |
| SMILES | CO[Si](C)(C)C.CO[Si](C)(CCc1ccc(S(=O)(=O)O)cc1)OC |
| InChI | InChI=1S/C11H18O5SSi.C4H12OSi/c1-15-18(3,16-2)9-8-10-4-6-11(7-5-10)17(12,13)14;1-5-6(2,3)4/h4-7H,8-9H2,1-3H3,(H,12,13,14);1-4H3 |
| InChIKey | BVBULFJALJPOQZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|