C14H16O8S2Si — CID 132580351
4-[dimethoxy-(4-sulfophenyl)silyl]benzenesulfonic acid (PubChem CID 132580351) has the molecular formula C14H16O8S2Si and a molecular weight of 404.49 g/mol. Its IUPAC name is 4-[dimethoxy-(4-sulfophenyl)silyl]benzenesulfonic acid.
| Compound Name | 4-[dimethoxy-(4-sulfophenyl)silyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 132580351 |
| Molecular Formula | C14H16O8S2Si |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 4-[dimethoxy-(4-sulfophenyl)silyl]benzenesulfonic acid |
| SMILES | CO[Si](OC)(c1ccc(S(=O)(=O)O)cc1)c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H16O8S2Si/c1-21-25(22-2,13-7-3-11(4-8-13)23(15,16)17)14-9-5-12(6-10-14)24(18,19)20/h3-10H,1-2H3,(H,15,16,17)(H,18,19,20) |
| InChIKey | IVPHXPPZDGMHNL-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|