C13H19F3O3Si — CID 90174295
diethoxy-methoxy-[2-(3,4,5-trifluorophenyl)ethyl]silane (PubChem CID 90174295) has the molecular formula C13H19F3O3Si and a molecular weight of 308.37 g/mol. Its IUPAC name is diethoxy-methoxy-[2-(3,4,5-trifluorophenyl)ethyl]silane.
| Compound Name | diethoxy-methoxy-[2-(3,4,5-trifluorophenyl)ethyl]silane |
|---|---|
| PubChem CID | 90174295 |
| Molecular Formula | C13H19F3O3Si |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | diethoxy-methoxy-[2-(3,4,5-trifluorophenyl)ethyl]silane |
| SMILES | CCO[Si](CCc1cc(F)c(F)c(F)c1)(OC)OCC |
| InChI | InChI=1S/C13H19F3O3Si/c1-4-18-20(17-3,19-5-2)7-6-10-8-11(14)13(16)12(15)9-10/h8-9H,4-7H2,1-3H3 |
| InChIKey | CDHLGLBTWWYZDZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|