C17H24F6O3Si — CID 90171444
4-[3,5-bis(trifluoromethyl)phenyl]butyl-diethoxy-methoxysilane (PubChem CID 90171444) has the molecular formula C17H24F6O3Si and a molecular weight of 418.45 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]butyl-diethoxy-methoxysilane.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]butyl-diethoxy-methoxysilane |
|---|---|
| PubChem CID | 90171444 |
| Molecular Formula | C17H24F6O3Si |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]butyl-diethoxy-methoxysilane |
| SMILES | CCO[Si](CCCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)(OC)OCC |
| InChI | InChI=1S/C17H24F6O3Si/c1-4-25-27(24-3,26-5-2)9-7-6-8-13-10-14(16(18,19)20)12-15(11-13)17(21,22)23/h10-12H,4-9H2,1-3H3 |
| InChIKey | QLPAMLBCWRQDDU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|