C16H25F3O3Si — CID 90173870
methoxy-di(propan-2-yloxy)-[2-[4-(trifluoromethyl)phenyl]ethyl]silane (PubChem CID 90173870) has the molecular formula C16H25F3O3Si and a molecular weight of 350.45 g/mol. Its IUPAC name is methoxy-di(propan-2-yloxy)-[2-[4-(trifluoromethyl)phenyl]ethyl]silane.
| Compound Name | methoxy-di(propan-2-yloxy)-[2-[4-(trifluoromethyl)phenyl]ethyl]silane |
|---|---|
| PubChem CID | 90173870 |
| Molecular Formula | C16H25F3O3Si |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | methoxy-di(propan-2-yloxy)-[2-[4-(trifluoromethyl)phenyl]ethyl]silane |
| SMILES | CO[Si](CCc1ccc(C(F)(F)F)cc1)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C16H25F3O3Si/c1-12(2)21-23(20-5,22-13(3)4)11-10-14-6-8-15(9-7-14)16(17,18)19/h6-9,12-13H,10-11H2,1-5H3 |
| InChIKey | FBPXNNDDIIZVHS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|