About trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane
trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane (PubChem CID 70127509) has the molecular formula C17H34O6Si2
and a molecular weight of 390.63 g/mol. Its IUPAC name is trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane.
Molecular Properties
| Compound Name | trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane |
| PubChem CID | 70127509 |
| Molecular Formula | C17H34O6Si2 |
| Molecular Weight | 390.63 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane |
| SMILES | CCC[Si](OC)(OC)OC.CO[Si](CCc1ccccc1)(OC)OC |
| InChI | InChI=1S/C11H18O3Si.C6H16O3Si/c1-12-15(13-2,14-3)10-9-11-7-5-4-6-8-11;1-5-6-10(7-2,8-3)9-4/h4-8H,9-10H2,1-3H3;5-6H2,1-4H3 |
| InChIKey | BOURBAZYESZDKI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane?
The IUPAC name of trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane (CID 70127509) is trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane.
What is the SMILES notation for trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane?
The canonical SMILES for trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane is CCC[Si](OC)(OC)OC.CO[Si](CCc1ccccc1)(OC)OC.
What is the InChIKey of trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane?
The InChIKey is BOURBAZYESZDKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3Si.C6H16O3Si/c1-12-15(13-2,14-3)10-9-11-7-5-4-6-8-11;1-5-6-10(7-2,8-3)9-4/h4-8H,9-10H2,1-3H3;5-6H2,1-4H3.
What are the key properties of trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane?
trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane has a molecular weight of 390.63 g/mol, XLogP of 3.38, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxy(2-phenylethyl)silane;trimethoxy(propyl)silane is sourced from PubChem (CID 70127509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).