C17H32N2O3Si — CID 66713657
2-benzylbut-3-ene-1,2-diamine;trimethoxy(propyl)silane (PubChem CID 66713657) has the molecular formula C17H32N2O3Si and a molecular weight of 340.54 g/mol. Its IUPAC name is 2-benzylbut-3-ene-1,2-diamine;trimethoxy(propyl)silane.
| Compound Name | 2-benzylbut-3-ene-1,2-diamine;trimethoxy(propyl)silane |
|---|---|
| PubChem CID | 66713657 |
| Molecular Formula | C17H32N2O3Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 2-benzylbut-3-ene-1,2-diamine;trimethoxy(propyl)silane |
| SMILES | C=CC(N)(CN)Cc1ccccc1.CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C11H16N2.C6H16O3Si/c1-2-11(13,9-12)8-10-6-4-3-5-7-10;1-5-6-10(7-2,8-3)9-4/h2-7H,1,8-9,12-13H2;5-6H2,1-4H3 |
| InChIKey | RAKXHXQPPIBGIL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|