C10H17ClOSi2 — CID 12729910
chloro-methyl-phenyl-trimethylsilyloxysilane (PubChem CID 12729910) has the molecular formula C10H17ClOSi2 and a molecular weight of 244.87 g/mol. Its IUPAC name is chloro-methyl-phenyl-trimethylsilyloxysilane.
| Compound Name | chloro-methyl-phenyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 12729910 |
| Molecular Formula | C10H17ClOSi2 |
| Molecular Weight | 244.87 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | chloro-methyl-phenyl-trimethylsilyloxysilane |
| SMILES | C[Si](C)(C)O[Si](C)(Cl)c1ccccc1 |
| InChI | InChI=1S/C10H17ClOSi2/c1-13(2,3)12-14(4,11)10-8-6-5-7-9-10/h5-9H,1-4H3 |
| InChIKey | IQHGZYWQELJWKV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.87 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|