C27H42OSi5 — CID 100992751
trimethyl-[methyl-[methyl-(methyl-phenyl-trimethylsilyloxysilyl)-phenylsilyl]-phenylsilyl]silane (PubChem CID 100992751) has the molecular formula C27H42OSi5 and a molecular weight of 523.06 g/mol. Its IUPAC name is trimethyl-[methyl-[methyl-(methyl-phenyl-trimethylsilyloxysilyl)-phenylsilyl]-phenylsilyl]silane.
| Compound Name | trimethyl-[methyl-[methyl-(methyl-phenyl-trimethylsilyloxysilyl)-phenylsilyl]-phenylsilyl]silane |
|---|---|
| PubChem CID | 100992751 |
| Molecular Formula | C27H42OSi5 |
| Molecular Weight | 523.06 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | trimethyl-[methyl-[methyl-(methyl-phenyl-trimethylsilyloxysilyl)-phenylsilyl]-phenylsilyl]silane |
| SMILES | C[Si](C)(C)O[Si](C)(c1ccccc1)[Si](C)(c1ccccc1)[Si](C)(c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C27H42OSi5/c1-29(2,3)28-31(7,25-19-13-10-14-20-25)33(9,27-23-17-12-18-24-27)32(8,30(4,5)6)26-21-15-11-16-22-26/h10-24H,1-9H3 |
| InChIKey | FQZMOCWGRQQRBP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.06 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|