C28H44Si5 — CID 54016114
dimethyl-[4-[methyl-[methyl(diphenyl)silyl]-trimethylsilylsilyl]phenyl]-trimethylsilylsilane (PubChem CID 54016114) has the molecular formula C28H44Si5 and a molecular weight of 521.09 g/mol. Its IUPAC name is dimethyl-[4-[methyl-[methyl(diphenyl)silyl]-trimethylsilylsilyl]phenyl]-trimethylsilylsilane.
| Compound Name | dimethyl-[4-[methyl-[methyl(diphenyl)silyl]-trimethylsilylsilyl]phenyl]-trimethylsilylsilane |
|---|---|
| PubChem CID | 54016114 |
| Molecular Formula | C28H44Si5 |
| Molecular Weight | 521.09 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | dimethyl-[4-[methyl-[methyl(diphenyl)silyl]-trimethylsilylsilyl]phenyl]-trimethylsilylsilane |
| SMILES | C[Si](C)(C)[Si](C)(C)c1ccc([Si](C)([Si](C)(C)C)[Si](C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H44Si5/c1-29(2,3)31(7,8)25-21-23-28(24-22-25)33(10,30(4,5)6)32(9,26-17-13-11-14-18-26)27-19-15-12-16-20-27/h11-24H,1-10H3 |
| InChIKey | KVSWJXAZBWRDJB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.09 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|