C18H22F4Si2 — CID 10926773
[2-[dimethyl(phenyl)silyl]-1,1,2,2-tetrafluoroethyl]-dimethyl-phenylsilane (PubChem CID 10926773) has the molecular formula C18H22F4Si2 and a molecular weight of 370.54 g/mol. Its IUPAC name is [2-[dimethyl(phenyl)silyl]-1,1,2,2-tetrafluoroethyl]-dimethyl-phenylsilane.
| Compound Name | [2-[dimethyl(phenyl)silyl]-1,1,2,2-tetrafluoroethyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 10926773 |
| Molecular Formula | C18H22F4Si2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [2-[dimethyl(phenyl)silyl]-1,1,2,2-tetrafluoroethyl]-dimethyl-phenylsilane |
| SMILES | C[Si](C)(c1ccccc1)C(F)(F)C(F)(F)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H22F4Si2/c1-23(2,15-11-7-5-8-12-15)17(19,20)18(21,22)24(3,4)16-13-9-6-10-14-16/h5-14H,1-4H3 |
| InChIKey | QVWBKKPHRQYLHC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|