C11H13F3Si — CID 11401963
dimethyl-phenyl-(3,3,3-trifluoroprop-1-en-2-yl)silane (PubChem CID 11401963) has the molecular formula C11H13F3Si and a molecular weight of 230.31 g/mol. Its IUPAC name is dimethyl-phenyl-(3,3,3-trifluoroprop-1-en-2-yl)silane.
| Compound Name | dimethyl-phenyl-(3,3,3-trifluoroprop-1-en-2-yl)silane |
|---|---|
| PubChem CID | 11401963 |
| Molecular Formula | C11H13F3Si |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | dimethyl-phenyl-(3,3,3-trifluoroprop-1-en-2-yl)silane |
| SMILES | C=C(C(F)(F)F)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C11H13F3Si/c1-9(11(12,13)14)15(2,3)10-7-5-4-6-8-10/h4-8H,1H2,2-3H3 |
| InChIKey | VPXWFEWRBGEQKN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|