C20H25CuSi — CID 177413805
copper(1+);(3,3-dimethyl-1-phenylbut-1-en-2-yl)-dimethyl-phenylsilane (PubChem CID 177413805) has the molecular formula C20H25CuSi and a molecular weight of 357.05 g/mol. Its IUPAC name is copper(1+);(3,3-dimethyl-1-phenylbut-1-en-2-yl)-dimethyl-phenylsilane.
| Compound Name | copper(1+);(3,3-dimethyl-1-phenylbut-1-en-2-yl)-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 177413805 |
| Molecular Formula | C20H25CuSi |
| Molecular Weight | 357.05 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | copper(1+);(3,3-dimethyl-1-phenylbut-1-en-2-yl)-dimethyl-phenylsilane |
| SMILES | CC(C)(C)/C(=[C-]\c1ccccc1)[Si](C)(C)c1ccccc1.[Cu+] |
| InChI | InChI=1S/C20H25Si.Cu/c1-20(2,3)19(16-17-12-8-6-9-13-17)21(4,5)18-14-10-7-11-15-18;/h6-15H,1-5H3;/q-1;+1 |
| InChIKey | OEEPLBADAYERCN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.05 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|