About tert-butyl-dimethyl-triphenylsilylsilane
tert-butyl-dimethyl-triphenylsilylsilane (PubChem CID 14143704) has the molecular formula C24H30Si2
and a molecular weight of 374.68 g/mol. Its IUPAC name is tert-butyl-dimethyl-triphenylsilylsilane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-triphenylsilylsilane |
| PubChem CID | 14143704 |
| Molecular Formula | C24H30Si2 |
| Molecular Weight | 374.68 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | tert-butyl-dimethyl-triphenylsilylsilane |
| SMILES | CC(C)(C)[Si](C)(C)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H30Si2/c1-24(2,3)25(4,5)26(21-15-9-6-10-16-21,22-17-11-7-12-18-22)23-19-13-8-14-20-23/h6-20H,1-5H3 |
| InChIKey | VSWFJEPHKLEMQF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-triphenylsilylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-triphenylsilylsilane?
The IUPAC name of tert-butyl-dimethyl-triphenylsilylsilane (CID 14143704) is tert-butyl-dimethyl-triphenylsilylsilane.
What is the SMILES notation for tert-butyl-dimethyl-triphenylsilylsilane?
The canonical SMILES for tert-butyl-dimethyl-triphenylsilylsilane is CC(C)(C)[Si](C)(C)[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl-dimethyl-triphenylsilylsilane?
The InChIKey is VSWFJEPHKLEMQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30Si2/c1-24(2,3)25(4,5)26(21-15-9-6-10-16-21,22-17-11-7-12-18-22)23-19-13-8-14-20-23/h6-20H,1-5H3.
What are the key properties of tert-butyl-dimethyl-triphenylsilylsilane?
tert-butyl-dimethyl-triphenylsilylsilane has a molecular weight of 374.68 g/mol, XLogP of 4.74, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-triphenylsilylsilane is sourced from PubChem (CID 14143704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).