potassium ditert-butyl-oxido-phenylsilane

C14H23KOSi — CID 101338176

IUPACpotassium ditert-butyl-oxido-phenylsilane
SMILESCC(C)(C)[Si]([O-])(c1ccccc1)C(C)(C)C.[K+]
InChIInChI=1S/C14H23OSi.K/c1-13(2,3)16(15,14(4,5)6)12-10-8-7-9-11-12;/h7-11H,1-6H3;/q-1;+1
InChIKeyGLWHRQQLRLTWAC-UHFFFAOYSA-N
MW274.52 g/mol
LogP-0.20
Rot. Bonds1

About potassium ditert-butyl-oxido-phenylsilane

potassium ditert-butyl-oxido-phenylsilane (PubChem CID 101338176) has the molecular formula C14H23KOSi and a molecular weight of 274.52 g/mol. Its IUPAC name is potassium ditert-butyl-oxido-phenylsilane.

Molecular Properties

Compound Namepotassium ditert-butyl-oxido-phenylsilane
PubChem CID101338176
Molecular FormulaC14H23KOSi
Molecular Weight274.52 g/mol
Exact Mass274.12
IUPAC Namepotassium ditert-butyl-oxido-phenylsilane
SMILESCC(C)(C)[Si]([O-])(c1ccccc1)C(C)(C)C.[K+]
InChIInChI=1S/C14H23OSi.K/c1-13(2,3)16(15,14(4,5)6)12-10-8-7-9-11-12;/h7-11H,1-6H3;/q-1;+1
InChIKeyGLWHRQQLRLTWAC-UHFFFAOYSA-N
XLogP-0.20
TPSA23.06 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.52
LogP ≤ 5-0.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze potassium ditert-butyl-oxido-phenylsilane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium ditert-butyl-oxido-phenylsilane?
The IUPAC name of potassium ditert-butyl-oxido-phenylsilane (CID 101338176) is potassium ditert-butyl-oxido-phenylsilane.
What is the SMILES notation for potassium ditert-butyl-oxido-phenylsilane?
The canonical SMILES for potassium ditert-butyl-oxido-phenylsilane is CC(C)(C)[Si]([O-])(c1ccccc1)C(C)(C)C.[K+].
What is the InChIKey of potassium ditert-butyl-oxido-phenylsilane?
The InChIKey is GLWHRQQLRLTWAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23OSi.K/c1-13(2,3)16(15,14(4,5)6)12-10-8-7-9-11-12;/h7-11H,1-6H3;/q-1;+1.
What are the key properties of potassium ditert-butyl-oxido-phenylsilane?
potassium ditert-butyl-oxido-phenylsilane has a molecular weight of 274.52 g/mol, XLogP of -0.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium ditert-butyl-oxido-phenylsilane is sourced from PubChem (CID 101338176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).