About dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene
dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene (PubChem CID 159821402) has the molecular formula C29H32Si
and a molecular weight of 408.66 g/mol. Its IUPAC name is dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene.
Molecular Properties
| Compound Name | dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene |
| PubChem CID | 159821402 |
| Molecular Formula | C29H32Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene |
| SMILES | CC(C)(c1ccccc1)c1ccccc1.C[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16.C14H16Si/c2*1-15(2,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h2*3-12H,1-2H3 |
| InChIKey | NMHASRXSZXVSME-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene?
The IUPAC name of dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene (CID 159821402) is dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene.
What is the SMILES notation for dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene?
The canonical SMILES for dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene is CC(C)(c1ccccc1)c1ccccc1.C[Si](C)(c1ccccc1)c1ccccc1.
What is the InChIKey of dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene?
The InChIKey is NMHASRXSZXVSME-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16.C14H16Si/c2*1-15(2,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h2*3-12H,1-2H3.
What are the key properties of dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene?
dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene has a molecular weight of 408.66 g/mol, XLogP of 6.52, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(diphenyl)silane;2-phenylpropan-2-ylbenzene is sourced from PubChem (CID 159821402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).