C17H22Si — CID 553309
1,1-diphenylethyl(trimethyl)silane (PubChem CID 553309) has the molecular formula C17H22Si and a molecular weight of 254.45 g/mol. Its IUPAC name is 1,1-diphenylethyl(trimethyl)silane.
| Compound Name | 1,1-diphenylethyl(trimethyl)silane |
|---|---|
| PubChem CID | 553309 |
| Molecular Formula | C17H22Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1,1-diphenylethyl(trimethyl)silane |
| SMILES | CC(c1ccccc1)(c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C17H22Si/c1-17(18(2,3)4,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,1-4H3 |
| InChIKey | ONTHBYXLQCUARK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|