C22H34O2Si2 — CID 10068766
(2,3-diphenyl-3-trimethylsilyloxybutan-2-yl)oxy-trimethylsilane (PubChem CID 10068766) has the molecular formula C22H34O2Si2 and a molecular weight of 386.68 g/mol. Its IUPAC name is (2,3-diphenyl-3-trimethylsilyloxybutan-2-yl)oxy-trimethylsilane.
| Compound Name | (2,3-diphenyl-3-trimethylsilyloxybutan-2-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 10068766 |
| Molecular Formula | C22H34O2Si2 |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (2,3-diphenyl-3-trimethylsilyloxybutan-2-yl)oxy-trimethylsilane |
| SMILES | CC(O[Si](C)(C)C)(c1ccccc1)C(C)(O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H34O2Si2/c1-21(23-25(3,4)5,19-15-11-9-12-16-19)22(2,24-26(6,7)8)20-17-13-10-14-18-20/h9-18H,1-8H3 |
| InChIKey | RCDDUVKQTCMFKM-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|