C14H24O3Si2 — CID 54395913
(2S)-2-phenyl-2-trimethylsilyl-2-trimethylsilyloxyacetic acid (PubChem CID 54395913) has the molecular formula C14H24O3Si2 and a molecular weight of 296.51 g/mol. Its IUPAC name is (2S)-2-phenyl-2-trimethylsilyl-2-trimethylsilyloxyacetic acid.
| Compound Name | (2S)-2-phenyl-2-trimethylsilyl-2-trimethylsilyloxyacetic acid |
|---|---|
| PubChem CID | 54395913 |
| Molecular Formula | C14H24O3Si2 |
| Molecular Weight | 296.51 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2S)-2-phenyl-2-trimethylsilyl-2-trimethylsilyloxyacetic acid |
| SMILES | C[Si](C)(C)O[C@@](C(=O)O)(c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C14H24O3Si2/c1-18(2,3)14(13(15)16,17-19(4,5)6)12-10-8-7-9-11-12/h7-11H,1-6H3,(H,15,16)/t14-/m0/s1 |
| InChIKey | VJXWVNMCVXXROJ-AWEZNQCLSA-N |
| XLogP | 3.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|