C20H28O3Si2 — CID 170850849
2-phenyl-2-trimethylsilyloxy-2-(2-trimethylsilylphenyl)acetic acid (PubChem CID 170850849) has the molecular formula C20H28O3Si2 and a molecular weight of 372.61 g/mol. Its IUPAC name is 2-phenyl-2-trimethylsilyloxy-2-(2-trimethylsilylphenyl)acetic acid.
| Compound Name | 2-phenyl-2-trimethylsilyloxy-2-(2-trimethylsilylphenyl)acetic acid |
|---|---|
| PubChem CID | 170850849 |
| Molecular Formula | C20H28O3Si2 |
| Molecular Weight | 372.61 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-phenyl-2-trimethylsilyloxy-2-(2-trimethylsilylphenyl)acetic acid |
| SMILES | C[Si](C)(C)OC(C(=O)O)(c1ccccc1)c1ccccc1[Si](C)(C)C |
| InChI | InChI=1S/C20H28O3Si2/c1-24(2,3)18-15-11-10-14-17(18)20(19(21)22,23-25(4,5)6)16-12-8-7-9-13-16/h7-15H,1-6H3,(H,21,22) |
| InChIKey | NRPXAJJQHBDCHM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|