C26H40O3Si2 — CID 57371434
2-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(dimethyl)silyl]phenyl]-2-phenylacetic acid (PubChem CID 57371434) has the molecular formula C26H40O3Si2 and a molecular weight of 456.78 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(dimethyl)silyl]phenyl]-2-phenylacetic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(dimethyl)silyl]phenyl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 57371434 |
| Molecular Formula | C26H40O3Si2 |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(dimethyl)silyl]phenyl]-2-phenylacetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(C(=O)O)(c1ccccc1)c1ccccc1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H40O3Si2/c1-24(2,3)30(7,8)22-19-15-14-18-21(22)26(23(27)28,20-16-12-11-13-17-20)29-31(9,10)25(4,5)6/h11-19H,1-10H3,(H,27,28) |
| InChIKey | XPNOPHUVTWGPHS-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|