C20H26O2Si — CID 10806072
2-[tert-butyl(dimethyl)silyl]oxy-2,2-diphenylacetaldehyde (PubChem CID 10806072) has the molecular formula C20H26O2Si and a molecular weight of 326.51 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-2,2-diphenylacetaldehyde.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-2,2-diphenylacetaldehyde |
|---|---|
| PubChem CID | 10806072 |
| Molecular Formula | C20H26O2Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-2,2-diphenylacetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC(C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26O2Si/c1-19(2,3)23(4,5)22-20(16-21,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-16H,1-5H3 |
| InChIKey | XBOTWIGJWGHQHS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|