C20H33NO4Si — CID 154460917
tert-butyl (2S,3R)-3-amino-3-[tert-butyl(dimethyl)silyl]oxy-4-oxo-2-phenylbutanoate (PubChem CID 154460917) has the molecular formula C20H33NO4Si and a molecular weight of 379.57 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-amino-3-[tert-butyl(dimethyl)silyl]oxy-4-oxo-2-phenylbutanoate.
| Compound Name | tert-butyl (2S,3R)-3-amino-3-[tert-butyl(dimethyl)silyl]oxy-4-oxo-2-phenylbutanoate |
|---|---|
| PubChem CID | 154460917 |
| Molecular Formula | C20H33NO4Si |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | tert-butyl (2S,3R)-3-amino-3-[tert-butyl(dimethyl)silyl]oxy-4-oxo-2-phenylbutanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](c1ccccc1)[C@](N)(C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H33NO4Si/c1-18(2,3)24-17(23)16(15-12-10-9-11-13-15)20(21,14-22)25-26(7,8)19(4,5)6/h9-14,16H,21H2,1-8H3/t16-,20+/m1/s1 |
| InChIKey | BLZVCMUPVJTLLY-UZLBHIALSA-N |
| XLogP | 3.99 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|