C20H28O3Si — CID 101496168
(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-prop-2-ynylpent-4-enoic acid (PubChem CID 101496168) has the molecular formula C20H28O3Si and a molecular weight of 344.53 g/mol. Its IUPAC name is (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-prop-2-ynylpent-4-enoic acid.
| Compound Name | (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-prop-2-ynylpent-4-enoic acid |
|---|---|
| PubChem CID | 101496168 |
| Molecular Formula | C20H28O3Si |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-prop-2-ynylpent-4-enoic acid |
| SMILES | C#CC[C@@](O[Si](C)(C)C(C)(C)C)(C(=O)O)[C@@H](C=C)c1ccccc1 |
| InChI | InChI=1S/C20H28O3Si/c1-8-15-20(18(21)22,23-24(6,7)19(3,4)5)17(9-2)16-13-11-10-12-14-16/h1,9-14,17H,2,15H2,3-7H3,(H,21,22)/t17-,20-/m0/s1 |
| InChIKey | QJRVIXVZXILUPV-PXNSSMCTSA-N |
| XLogP | 4.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|