C19H28O3Si — CID 140540638
(2R)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]hex-5-ynoic acid (PubChem CID 140540638) has the molecular formula C19H28O3Si and a molecular weight of 332.52 g/mol. Its IUPAC name is (2R)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]hex-5-ynoic acid.
| Compound Name | (2R)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]hex-5-ynoic acid |
|---|---|
| PubChem CID | 140540638 |
| Molecular Formula | C19H28O3Si |
| Molecular Weight | 332.52 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (2R)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]hex-5-ynoic acid |
| SMILES | C#CCC[C@@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H28O3Si/c1-7-8-14-16(18(20)21)17(15-12-10-9-11-13-15)22-23(5,6)19(2,3)4/h1,9-13,16-17H,8,14H2,2-6H3,(H,20,21)/t16-,17+/m1/s1 |
| InChIKey | PBFRLNSQQDIADY-SJORKVTESA-N |
| XLogP | 4.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|