C27H37NO4Si — CID 87211450
[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-yn-2-yl]-[(4-methoxyphenyl)methyl]carbamic acid (PubChem CID 87211450) has the molecular formula C27H37NO4Si and a molecular weight of 467.68 g/mol. Its IUPAC name is [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-yn-2-yl]-[(4-methoxyphenyl)methyl]carbamic acid.
| Compound Name | [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-yn-2-yl]-[(4-methoxyphenyl)methyl]carbamic acid |
|---|---|
| PubChem CID | 87211450 |
| Molecular Formula | C27H37NO4Si |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-yn-2-yl]-[(4-methoxyphenyl)methyl]carbamic acid |
| SMILES | C#CCC[C@H](C(O[Si](C)(C)C(C)(C)C)c1ccccc1)N(Cc1ccc(OC)cc1)C(=O)O |
| InChI | InChI=1S/C27H37NO4Si/c1-8-9-15-24(28(26(29)30)20-21-16-18-23(31-5)19-17-21)25(22-13-11-10-12-14-22)32-33(6,7)27(2,3)4/h1,10-14,16-19,24-25H,9,15,20H2,2-7H3,(H,29,30)/t24-,25?/m1/s1 |
| InChIKey | JEFBLAALBLBVLT-IKOFQBKESA-N |
| XLogP | 6.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|