C26H37NO4Si — CID 11590604
tert-butyl (2S,3S)-2-benzamido-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropanoate (PubChem CID 11590604) has the molecular formula C26H37NO4Si and a molecular weight of 455.67 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-benzamido-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropanoate.
| Compound Name | tert-butyl (2S,3S)-2-benzamido-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 11590604 |
| Molecular Formula | C26H37NO4Si |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | tert-butyl (2S,3S)-2-benzamido-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](NC(=O)c1ccccc1)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H37NO4Si/c1-25(2,3)30-24(29)21(27-23(28)20-17-13-10-14-18-20)22(19-15-11-9-12-16-19)31-32(7,8)26(4,5)6/h9-18,21-22H,1-8H3,(H,27,28)/t21-,22-/m0/s1 |
| InChIKey | JGZBFAUJKDHYFD-VXKWHMMOSA-N |
| XLogP | 5.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|