C24H32ClNO2Si — CID 101494669
N-[(E,1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-chloro-1-phenylpent-3-enyl]benzamide (PubChem CID 101494669) has the molecular formula C24H32ClNO2Si and a molecular weight of 430.06 g/mol. Its IUPAC name is N-[(E,1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-chloro-1-phenylpent-3-enyl]benzamide.
| Compound Name | N-[(E,1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-chloro-1-phenylpent-3-enyl]benzamide |
|---|---|
| PubChem CID | 101494669 |
| Molecular Formula | C24H32ClNO2Si |
| Molecular Weight | 430.06 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-[(E,1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-chloro-1-phenylpent-3-enyl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](/C=C/CCl)[C@@H](NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32ClNO2Si/c1-24(2,3)29(4,5)28-21(17-12-18-25)22(19-13-8-6-9-14-19)26-23(27)20-15-10-7-11-16-20/h6-17,21-22H,18H2,1-5H3,(H,26,27)/b17-12+/t21-,22+/m1/s1 |
| InChIKey | AGGGNYNGRHUOHA-IOITUILOSA-N |
| XLogP | 6.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.06 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|