C25H34O4Si — CID 11059015
[(2R,3S,4E,6E,8E,10E)-3-[tert-butyl(dimethyl)silyl]oxy-12-oxododeca-4,6,8,10-tetraen-2-yl] benzoate (PubChem CID 11059015) has the molecular formula C25H34O4Si and a molecular weight of 426.63 g/mol. Its IUPAC name is [(2R,3S,4E,6E,8E,10E)-3-[tert-butyl(dimethyl)silyl]oxy-12-oxododeca-4,6,8,10-tetraen-2-yl] benzoate.
| Compound Name | [(2R,3S,4E,6E,8E,10E)-3-[tert-butyl(dimethyl)silyl]oxy-12-oxododeca-4,6,8,10-tetraen-2-yl] benzoate |
|---|---|
| PubChem CID | 11059015 |
| Molecular Formula | C25H34O4Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | [(2R,3S,4E,6E,8E,10E)-3-[tert-butyl(dimethyl)silyl]oxy-12-oxododeca-4,6,8,10-tetraen-2-yl] benzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1)[C@H](/C=C/C=C/C=C/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H34O4Si/c1-21(28-24(27)22-17-13-12-14-18-22)23(29-30(5,6)25(2,3)4)19-15-10-8-7-9-11-16-20-26/h7-21,23H,1-6H3/b9-7+,10-8+,16-11+,19-15+/t21-,23+/m1/s1 |
| InChIKey | FSYIBZAKAYTSFP-VSGISHMOSA-N |
| XLogP | 6.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|