C19H28O4Si — CID 11152252
[(2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhex-5-yn-2-yl] benzoate (PubChem CID 11152252) has the molecular formula C19H28O4Si and a molecular weight of 348.52 g/mol. Its IUPAC name is [(2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhex-5-yn-2-yl] benzoate.
| Compound Name | [(2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhex-5-yn-2-yl] benzoate |
|---|---|
| PubChem CID | 11152252 |
| Molecular Formula | C19H28O4Si |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | [(2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhex-5-yn-2-yl] benzoate |
| SMILES | C#C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H28O4Si/c1-8-16(23-24(6,7)19(3,4)5)17(20)14(2)22-18(21)15-12-10-9-11-13-15/h1,9-14,16-17,20H,2-7H3/t14-,16+,17-/m1/s1 |
| InChIKey | YXAYNAZCXJWVOX-HYVNUMGLSA-N |
| XLogP | 3.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|