C25H41NO6Si2 — CID 11295127
[(2S,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-yn-2-yl] 4-nitrobenzoate (PubChem CID 11295127) has the molecular formula C25H41NO6Si2 and a molecular weight of 507.78 g/mol. Its IUPAC name is [(2S,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-yn-2-yl] 4-nitrobenzoate.
| Compound Name | [(2S,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-yn-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 11295127 |
| Molecular Formula | C25H41NO6Si2 |
| Molecular Weight | 507.78 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | [(2S,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-yn-2-yl] 4-nitrobenzoate |
| SMILES | C#C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H41NO6Si2/c1-13-21(31-33(9,10)24(3,4)5)22(32-34(11,12)25(6,7)8)18(2)30-23(27)19-14-16-20(17-15-19)26(28)29/h1,14-18,21-22H,2-12H3/t18-,21-,22+/m0/s1 |
| InChIKey | NNSMHDZRCXENDZ-YUXAGFNASA-N |
| XLogP | 6.55 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.78 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|