C22H29NO5Si — CID 11144169
[(1S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-ethynyl-4-methylcyclohex-3-en-1-yl] 4-nitrobenzoate (PubChem CID 11144169) has the molecular formula C22H29NO5Si and a molecular weight of 415.56 g/mol. Its IUPAC name is [(1S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-ethynyl-4-methylcyclohex-3-en-1-yl] 4-nitrobenzoate.
| Compound Name | [(1S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-ethynyl-4-methylcyclohex-3-en-1-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 11144169 |
| Molecular Formula | C22H29NO5Si |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | [(1S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-ethynyl-4-methylcyclohex-3-en-1-yl] 4-nitrobenzoate |
| SMILES | C#CC1=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C22H29NO5Si/c1-8-16-13-19(14-20(15(16)2)28-29(6,7)22(3,4)5)27-21(24)17-9-11-18(12-10-17)23(25)26/h1,9-12,19-20H,13-14H2,2-7H3/t19-,20-/m0/s1 |
| InChIKey | KGFNBKGUYLCGJW-PMACEKPBSA-N |
| XLogP | 5.25 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|