C22H34O5Si — CID 58510408
[(2R,4R)-3,4-dihydroxy-1-tri(propan-2-yl)silyloxyhex-5-yn-2-yl] benzoate (PubChem CID 58510408) has the molecular formula C22H34O5Si and a molecular weight of 406.60 g/mol. Its IUPAC name is [(2R,4R)-3,4-dihydroxy-1-tri(propan-2-yl)silyloxyhex-5-yn-2-yl] benzoate.
| Compound Name | [(2R,4R)-3,4-dihydroxy-1-tri(propan-2-yl)silyloxyhex-5-yn-2-yl] benzoate |
|---|---|
| PubChem CID | 58510408 |
| Molecular Formula | C22H34O5Si |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | [(2R,4R)-3,4-dihydroxy-1-tri(propan-2-yl)silyloxyhex-5-yn-2-yl] benzoate |
| SMILES | C#C[C@@H](O)C(O)[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H34O5Si/c1-8-19(23)21(24)20(27-22(25)18-12-10-9-11-13-18)14-26-28(15(2)3,16(4)5)17(6)7/h1,9-13,15-17,19-21,23-24H,14H2,2-7H3/t19-,20-,21?/m1/s1 |
| InChIKey | BWSXHHPINXBSCI-OSBQEZSISA-N |
| XLogP | 3.76 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|