C23H38O4Si — CID 101178489
[(2R,3S)-3-[(2R,3S)-3-methyloxiran-2-yl]-1-tri(propan-2-yl)silyloxybutan-2-yl] benzoate (PubChem CID 101178489) has the molecular formula C23H38O4Si and a molecular weight of 406.64 g/mol. Its IUPAC name is [(2R,3S)-3-[(2R,3S)-3-methyloxiran-2-yl]-1-tri(propan-2-yl)silyloxybutan-2-yl] benzoate.
| Compound Name | [(2R,3S)-3-[(2R,3S)-3-methyloxiran-2-yl]-1-tri(propan-2-yl)silyloxybutan-2-yl] benzoate |
|---|---|
| PubChem CID | 101178489 |
| Molecular Formula | C23H38O4Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | [(2R,3S)-3-[(2R,3S)-3-methyloxiran-2-yl]-1-tri(propan-2-yl)silyloxybutan-2-yl] benzoate |
| SMILES | CC(C)[Si](OC[C@H](OC(=O)c1ccccc1)[C@H](C)[C@H]1O[C@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H38O4Si/c1-15(2)28(16(3)4,17(5)6)25-14-21(18(7)22-19(8)26-22)27-23(24)20-12-10-9-11-13-20/h9-13,15-19,21-22H,14H2,1-8H3/t18-,19-,21-,22+/m0/s1 |
| InChIKey | ZBLMNKDPYILHRV-BLKABHOGSA-N |
| XLogP | 5.83 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|