C39H70O7Si3 — CID 11170101
[(3S,4R,5R,6R,7S,10R,11S,12R)-6,12-bis[[tert-butyl(dimethyl)silyl]oxy]-10-hydroxy-3-methoxy-5,7,11-trimethyl-8-oxo-1-trimethylsilyltridec-1-yn-4-yl] benzoate (PubChem CID 11170101) has the molecular formula C39H70O7Si3 and a molecular weight of 735.24 g/mol. Its IUPAC name is [(3S,4R,5R,6R,7S,10R,11S,12R)-6,12-bis[[tert-butyl(dimethyl)silyl]oxy]-10-hydroxy-3-methoxy-5,7,11-trimethyl-8-oxo-1-trimethylsilyltridec-1-yn-4-yl] benzoate.
| Compound Name | [(3S,4R,5R,6R,7S,10R,11S,12R)-6,12-bis[[tert-butyl(dimethyl)silyl]oxy]-10-hydroxy-3-methoxy-5,7,11-trimethyl-8-oxo-1-trimethylsilyltridec-1-yn-4-yl] benzoate |
|---|---|
| PubChem CID | 11170101 |
| Molecular Formula | C39H70O7Si3 |
| Molecular Weight | 735.24 g/mol |
| Exact Mass | 734.44 |
| IUPAC Name | [(3S,4R,5R,6R,7S,10R,11S,12R)-6,12-bis[[tert-butyl(dimethyl)silyl]oxy]-10-hydroxy-3-methoxy-5,7,11-trimethyl-8-oxo-1-trimethylsilyltridec-1-yn-4-yl] benzoate |
| SMILES | CO[C@@H](C#C[Si](C)(C)C)[C@H](OC(=O)c1ccccc1)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)C[C@@H](O)[C@H](C)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H70O7Si3/c1-27(30(4)45-48(15,16)38(5,6)7)32(40)26-33(41)28(2)35(46-49(17,18)39(8,9)10)29(3)36(34(43-11)24-25-47(12,13)14)44-37(42)31-22-20-19-21-23-31/h19-23,27-30,32,34-36,40H,26H2,1-18H3/t27-,28-,29+,30-,32-,34+,35+,36-/m1/s1 |
| InChIKey | PPXGGBDZCYWQPI-URUWACPZSA-N |
| XLogP | 9.14 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.24 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|