C34H66O6Si4 — CID 101079538
[(Z,2R,3S,4R,5S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-1,2-bis(trimethylsilyloxy)oct-6-en-3-yl] benzoate (PubChem CID 101079538) has the molecular formula C34H66O6Si4 and a molecular weight of 683.24 g/mol. Its IUPAC name is [(Z,2R,3S,4R,5S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-1,2-bis(trimethylsilyloxy)oct-6-en-3-yl] benzoate.
| Compound Name | [(Z,2R,3S,4R,5S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-1,2-bis(trimethylsilyloxy)oct-6-en-3-yl] benzoate |
|---|---|
| PubChem CID | 101079538 |
| Molecular Formula | C34H66O6Si4 |
| Molecular Weight | 683.24 g/mol |
| Exact Mass | 682.39 |
| IUPAC Name | [(Z,2R,3S,4R,5S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-1,2-bis(trimethylsilyloxy)oct-6-en-3-yl] benzoate |
| SMILES | C[C@@H](/C=C\CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC(=O)c1ccccc1)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C34H66O6Si4/c1-27(22-21-25-36-43(14,15)33(2,3)4)30(40-44(16,17)34(5,6)7)31(38-32(35)28-23-19-18-20-24-28)29(39-42(11,12)13)26-37-41(8,9)10/h18-24,27,29-31H,25-26H2,1-17H3/b22-21-/t27-,29+,30+,31+/m0/s1 |
| InChIKey | UEXRUZZKYJNSLG-YYISGUACSA-N |
| XLogP | 9.89 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.24 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|