C28H52O3Si2 — CID 102121767
tert-butyl-[(E,2S,3R,4S)-2,4-dimethyl-1-phenylmethoxy-7-triethylsilyloxyhept-5-en-3-yl]oxy-dimethylsilane (PubChem CID 102121767) has the molecular formula C28H52O3Si2 and a molecular weight of 492.89 g/mol. Its IUPAC name is tert-butyl-[(E,2S,3R,4S)-2,4-dimethyl-1-phenylmethoxy-7-triethylsilyloxyhept-5-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2S,3R,4S)-2,4-dimethyl-1-phenylmethoxy-7-triethylsilyloxyhept-5-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102121767 |
| Molecular Formula | C28H52O3Si2 |
| Molecular Weight | 492.89 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | tert-butyl-[(E,2S,3R,4S)-2,4-dimethyl-1-phenylmethoxy-7-triethylsilyloxyhept-5-en-3-yl]oxy-dimethylsilane |
| SMILES | CC[Si](CC)(CC)OC/C=C/[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C28H52O3Si2/c1-11-33(12-2,13-3)30-21-17-18-24(4)27(31-32(9,10)28(6,7)8)25(5)22-29-23-26-19-15-14-16-20-26/h14-20,24-25,27H,11-13,21-23H2,1-10H3/b18-17+/t24-,25-,27+/m0/s1 |
| InChIKey | JXTWVPATARNSBT-PMBOVTNFSA-N |
| XLogP | 8.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.89 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|