C23H38O4Si — CID 71733874
methyl (E,4S,5R,6S)-4,6-dimethyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-enoate (PubChem CID 71733874) has the molecular formula C23H38O4Si and a molecular weight of 406.64 g/mol. Its IUPAC name is methyl (E,4S,5R,6S)-4,6-dimethyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-enoate.
| Compound Name | methyl (E,4S,5R,6S)-4,6-dimethyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-enoate |
|---|---|
| PubChem CID | 71733874 |
| Molecular Formula | C23H38O4Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | methyl (E,4S,5R,6S)-4,6-dimethyl-7-phenylmethoxy-5-triethylsilyloxyhept-2-enoate |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@@H](C)/C=C/C(=O)OC)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C23H38O4Si/c1-7-28(8-2,9-3)27-23(19(4)15-16-22(24)25-6)20(5)17-26-18-21-13-11-10-12-14-21/h10-16,19-20,23H,7-9,17-18H2,1-6H3/b16-15+/t19-,20-,23+/m0/s1 |
| InChIKey | VJMAUVFPRDVPAB-OGNCLAOASA-N |
| XLogP | 5.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|