C25H44O4Si2 — CID 10027466
(Z,2R,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-phenylmethoxyhex-4-enal (PubChem CID 10027466) has the molecular formula C25H44O4Si2 and a molecular weight of 464.80 g/mol. Its IUPAC name is (Z,2R,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-phenylmethoxyhex-4-enal.
| Compound Name | (Z,2R,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-phenylmethoxyhex-4-enal |
|---|---|
| PubChem CID | 10027466 |
| Molecular Formula | C25H44O4Si2 |
| Molecular Weight | 464.80 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | (Z,2R,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6-phenylmethoxyhex-4-enal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](C=O)[C@H](/C=C\COCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O4Si2/c1-24(2,3)30(7,8)28-22(23(19-26)29-31(9,10)25(4,5)6)17-14-18-27-20-21-15-12-11-13-16-21/h11-17,19,22-23H,18,20H2,1-10H3/b17-14-/t22-,23-/m0/s1 |
| InChIKey | MKYGOPPZSBHPNK-XOLJBUHUSA-N |
| XLogP | 6.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.80 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|