C26H38O4Si — CID 102359396
(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-bis(phenylmethoxy)hex-2-en-1-ol (PubChem CID 102359396) has the molecular formula C26H38O4Si and a molecular weight of 442.67 g/mol. Its IUPAC name is (E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-bis(phenylmethoxy)hex-2-en-1-ol.
| Compound Name | (E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-bis(phenylmethoxy)hex-2-en-1-ol |
|---|---|
| PubChem CID | 102359396 |
| Molecular Formula | C26H38O4Si |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | (E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-bis(phenylmethoxy)hex-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](COCc1ccccc1)[C@@H](/C=C/CO)OCc1ccccc1 |
| InChI | InChI=1S/C26H38O4Si/c1-26(2,3)31(4,5)30-25(21-28-19-22-13-8-6-9-14-22)24(17-12-18-27)29-20-23-15-10-7-11-16-23/h6-17,24-25,27H,18-21H2,1-5H3/b17-12+/t24-,25-/m1/s1 |
| InChIKey | NSHUXCOBVANJNE-CHPXNICDSA-N |
| XLogP | 5.73 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|