C44H77O8PSi3 — CID 102051391
[(E,4S,5S,6R,7S,9R)-1,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethyldec-2-en-5-yl] 2-diphenoxyphosphorylacetate (PubChem CID 102051391) has the molecular formula C44H77O8PSi3 and a molecular weight of 849.32 g/mol. Its IUPAC name is [(E,4S,5S,6R,7S,9R)-1,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethyldec-2-en-5-yl] 2-diphenoxyphosphorylacetate.
| Compound Name | [(E,4S,5S,6R,7S,9R)-1,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethyldec-2-en-5-yl] 2-diphenoxyphosphorylacetate |
|---|---|
| PubChem CID | 102051391 |
| Molecular Formula | C44H77O8PSi3 |
| Molecular Weight | 849.32 g/mol |
| Exact Mass | 848.47 |
| IUPAC Name | [(E,4S,5S,6R,7S,9R)-1,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethyldec-2-en-5-yl] 2-diphenoxyphosphorylacetate |
| SMILES | C[C@H]([C@@H](OC(=O)CP(=O)(Oc1ccccc1)Oc1ccccc1)[C@@H](C)/C=C/CO[Si](C)(C)C(C)(C)C)[C@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C44H77O8PSi3/c1-34(26-25-31-47-54(13,14)42(4,5)6)41(36(3)39(52-56(17,18)44(10,11)12)32-35(2)51-55(15,16)43(7,8)9)48-40(45)33-53(46,49-37-27-21-19-22-28-37)50-38-29-23-20-24-30-38/h19-30,34-36,39,41H,31-33H2,1-18H3/b26-25+/t34-,35+,36-,39-,41-/m0/s1 |
| InChIKey | FBUIKMKWOISOQB-QBDQUCRBSA-N |
| XLogP | 13.29 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.32 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|