C21H25O5P — CID 102260491
[(2S)-hept-6-en-2-yl] 2-diphenoxyphosphorylacetate (PubChem CID 102260491) has the molecular formula C21H25O5P and a molecular weight of 388.40 g/mol. Its IUPAC name is [(2S)-hept-6-en-2-yl] 2-diphenoxyphosphorylacetate.
| Compound Name | [(2S)-hept-6-en-2-yl] 2-diphenoxyphosphorylacetate |
|---|---|
| PubChem CID | 102260491 |
| Molecular Formula | C21H25O5P |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [(2S)-hept-6-en-2-yl] 2-diphenoxyphosphorylacetate |
| SMILES | C=CCCC[C@H](C)OC(=O)CP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C21H25O5P/c1-3-4-7-12-18(2)24-21(22)17-27(23,25-19-13-8-5-9-14-19)26-20-15-10-6-11-16-20/h3,5-6,8-11,13-16,18H,1,4,7,12,17H2,2H3/t18-/m0/s1 |
| InChIKey | SQHXZONHWQDLSG-SFHVURJKSA-N |
| XLogP | 5.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|