C14H19O5P — CID 91195065
ethyl (2R)-2-[phenoxy(prop-2-enyl)phosphoryl]oxypropanoate (PubChem CID 91195065) has the molecular formula C14H19O5P and a molecular weight of 298.28 g/mol. Its IUPAC name is ethyl (2R)-2-[phenoxy(prop-2-enyl)phosphoryl]oxypropanoate.
| Compound Name | ethyl (2R)-2-[phenoxy(prop-2-enyl)phosphoryl]oxypropanoate |
|---|---|
| PubChem CID | 91195065 |
| Molecular Formula | C14H19O5P |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | ethyl (2R)-2-[phenoxy(prop-2-enyl)phosphoryl]oxypropanoate |
| SMILES | C=CCP(=O)(Oc1ccccc1)O[C@H](C)C(=O)OCC |
| InChI | InChI=1S/C14H19O5P/c1-4-11-20(16,18-12(3)14(15)17-5-2)19-13-9-7-6-8-10-13/h4,6-10,12H,1,5,11H2,2-3H3/t12-,20?/m1/s1 |
| InChIKey | FTQHYJFZPXBYKQ-ZRIYNBNISA-N |
| XLogP | 3.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|