C22H36ClNO2Si — CID 101494665
N-[(E,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-8-chloro-2-methyloct-6-en-4-yl]benzamide (PubChem CID 101494665) has the molecular formula C22H36ClNO2Si and a molecular weight of 410.07 g/mol. Its IUPAC name is N-[(E,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-8-chloro-2-methyloct-6-en-4-yl]benzamide.
| Compound Name | N-[(E,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-8-chloro-2-methyloct-6-en-4-yl]benzamide |
|---|---|
| PubChem CID | 101494665 |
| Molecular Formula | C22H36ClNO2Si |
| Molecular Weight | 410.07 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | N-[(E,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-8-chloro-2-methyloct-6-en-4-yl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccccc1)[C@@H](/C=C/CCl)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H36ClNO2Si/c1-17(2)16-19(24-21(25)18-12-9-8-10-13-18)20(14-11-15-23)26-27(6,7)22(3,4)5/h8-14,17,19-20H,15-16H2,1-7H3,(H,24,25)/b14-11+/t19-,20+/m0/s1 |
| InChIKey | OBGFFGIKXVSDSW-APXBPELASA-N |
| XLogP | 6.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.07 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|