C17H24O3Si — CID 135026287
(E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxo-5-phenylpent-2-enal (PubChem CID 135026287) has the molecular formula C17H24O3Si and a molecular weight of 304.46 g/mol. Its IUPAC name is (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxo-5-phenylpent-2-enal.
| Compound Name | (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxo-5-phenylpent-2-enal |
|---|---|
| PubChem CID | 135026287 |
| Molecular Formula | C17H24O3Si |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxo-5-phenylpent-2-enal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](C(=O)/C=C/C=O)c1ccccc1 |
| InChI | InChI=1S/C17H24O3Si/c1-17(2,3)21(4,5)20-16(15(19)12-9-13-18)14-10-7-6-8-11-14/h6-13,16H,1-5H3/b12-9+/t16-/m1/s1 |
| InChIKey | QRCVBHUKROWRIU-ONOODXEBSA-N |
| XLogP | 4.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|