C30H32O2Si — CID 53330755
(Z)-2-[[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-1,5-diphenylpent-2-en-4-yn-1-one (PubChem CID 53330755) has the molecular formula C30H32O2Si and a molecular weight of 452.67 g/mol. Its IUPAC name is (Z)-2-[[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-1,5-diphenylpent-2-en-4-yn-1-one.
| Compound Name | (Z)-2-[[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-1,5-diphenylpent-2-en-4-yn-1-one |
|---|---|
| PubChem CID | 53330755 |
| Molecular Formula | C30H32O2Si |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (Z)-2-[[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-1,5-diphenylpent-2-en-4-yn-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OC(/C(=C/C#Cc1ccccc1)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H32O2Si/c1-30(2,3)33(4,5)32-29(26-21-13-8-14-22-26)27(28(31)25-19-11-7-12-20-25)23-15-18-24-16-9-6-10-17-24/h6-14,16-17,19-23,29H,1-5H3/b27-23+ |
| InChIKey | QONLWKDNNUGCRG-SLEBQGDGSA-N |
| XLogP | 7.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|